C17H14FNO3 — CID 176902560
3-(3-fluorophenyl)-6,7-dimethoxy-1H-quinolin-2-one (PubChem CID 176902560) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-6,7-dimethoxy-1H-quinolin-2-one.
| Compound Name | 3-(3-fluorophenyl)-6,7-dimethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 176902560 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-(3-fluorophenyl)-6,7-dimethoxy-1H-quinolin-2-one |
| SMILES | COc1cc2cc(-c3cccc(F)c3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C17H14FNO3/c1-21-15-8-11-7-13(10-4-3-5-12(18)6-10)17(20)19-14(11)9-16(15)22-2/h3-9H,1-2H3,(H,19,20) |
| InChIKey | LUTLJHZDWRXNCA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |