C13H12FNO2 — CID 174673027
3-(3-fluorophenyl)-4,5-dimethoxypyridine (PubChem CID 174673027) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-4,5-dimethoxypyridine.
| Compound Name | 3-(3-fluorophenyl)-4,5-dimethoxypyridine |
|---|---|
| PubChem CID | 174673027 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-(3-fluorophenyl)-4,5-dimethoxypyridine |
| SMILES | COc1cncc(-c2cccc(F)c2)c1OC |
| InChI | InChI=1S/C13H12FNO2/c1-16-12-8-15-7-11(13(12)17-2)9-4-3-5-10(14)6-9/h3-8H,1-2H3 |
| InChIKey | ZSBBNUJWAYQBGF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |