C40H75N3O5 — CID 129254044
[9-[(E)-2-[(dimethylamino)methylamino]ethylideneamino]oxy-17-[(Z)-non-2-enoyl]oxyheptadecyl] (Z)-non-2-enoate (PubChem CID 129254044) has the molecular formula C40H75N3O5 and a molecular weight of 678.06 g/mol. Its IUPAC name is [9-[(E)-2-[(dimethylamino)methylamino]ethylideneamino]oxy-17-[(Z)-non-2-enoyl]oxyheptadecyl] (Z)-non-2-enoate.
| Compound Name | [9-[(E)-2-[(dimethylamino)methylamino]ethylideneamino]oxy-17-[(Z)-non-2-enoyl]oxyheptadecyl] (Z)-non-2-enoate |
|---|---|
| PubChem CID | 129254044 |
| Molecular Formula | C40H75N3O5 |
| Molecular Weight | 678.06 g/mol |
| Exact Mass | 677.57 |
| IUPAC Name | [9-[(E)-2-[(dimethylamino)methylamino]ethylideneamino]oxy-17-[(Z)-non-2-enoyl]oxyheptadecyl] (Z)-non-2-enoate |
| SMILES | CCCCCC/C=C\C(=O)OCCCCCCCCC(CCCCCCCCOC(=O)/C=C\CCCCCC)O/N=C/CNCN(C)C |
| InChI | InChI=1S/C40H75N3O5/c1-5-7-9-11-19-25-31-39(44)46-35-27-21-15-13-17-23-29-38(48-42-34-33-41-37-43(3)4)30-24-18-14-16-22-28-36-47-40(45)32-26-20-12-10-8-6-2/h25-26,31-32,34,38,41H,5-24,27-30,33,35-37H2,1-4H3/b31-25-,32-26-,42-34+ |
| InChIKey | PDMKTVJACANKEE-HVDCQEPISA-N |
| XLogP | 10.07 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.06 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|