C47H87NO6 — CID 129254026
dihexyl (2Z,21Z)-12-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxytricosa-2,21-dienedioate (PubChem CID 129254026) has the molecular formula C47H87NO6 and a molecular weight of 762.21 g/mol. Its IUPAC name is dihexyl (2Z,21Z)-12-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxytricosa-2,21-dienedioate.
| Compound Name | dihexyl (2Z,21Z)-12-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxytricosa-2,21-dienedioate |
|---|---|
| PubChem CID | 129254026 |
| Molecular Formula | C47H87NO6 |
| Molecular Weight | 762.21 g/mol |
| Exact Mass | 761.65 |
| IUPAC Name | dihexyl (2Z,21Z)-12-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxytricosa-2,21-dienedioate |
| SMILES | CCCCCCOC(=O)/C=C\CCCCCCCCC(CCCCCCCC/C=C\C(=O)OCCCCCC)OC(=O)CC(C)(C)CC(C)(C)CN(C)C |
| InChI | InChI=1S/C47H87NO6/c1-9-11-13-31-37-52-43(49)35-29-25-21-17-15-19-23-27-33-42(54-45(51)39-46(3,4)40-47(5,6)41-48(7)8)34-28-24-20-16-18-22-26-30-36-44(50)53-38-32-14-12-10-2/h29-30,35-36,42H,9-28,31-34,37-41H2,1-8H3/b35-29-,36-30- |
| InChIKey | UQUKMGAPJUJJLJ-YSVNBZGQSA-N |
| XLogP | 12.89 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.21 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|