C47H83NO6 — CID 129253935
1,17-bis[[(2Z,5Z)-nona-2,5-dienoyl]oxy]heptadecan-9-yl 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate (PubChem CID 129253935) has the molecular formula C47H83NO6 and a molecular weight of 758.18 g/mol. Its IUPAC name is 1,17-bis[[(2Z,5Z)-nona-2,5-dienoyl]oxy]heptadecan-9-yl 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate.
| Compound Name | 1,17-bis[[(2Z,5Z)-nona-2,5-dienoyl]oxy]heptadecan-9-yl 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 129253935 |
| Molecular Formula | C47H83NO6 |
| Molecular Weight | 758.18 g/mol |
| Exact Mass | 757.62 |
| IUPAC Name | 1,17-bis[[(2Z,5Z)-nona-2,5-dienoyl]oxy]heptadecan-9-yl 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate |
| SMILES | CCC/C=C\C/C=C\C(=O)OCCCCCCCCC(CCCCCCCCOC(=O)/C=C\C/C=C\CCC)OC(=O)CC(C)(C)CC(C)(C)CN(C)C |
| InChI | InChI=1S/C47H83NO6/c1-9-11-13-15-23-29-35-43(49)52-37-31-25-19-17-21-27-33-42(54-45(51)39-46(3,4)40-47(5,6)41-48(7)8)34-28-22-18-20-26-32-38-53-44(50)36-30-24-16-14-12-10-2/h13-16,29-30,35-36,42H,9-12,17-28,31-34,37-41H2,1-8H3/b15-13-,16-14-,35-29-,36-30- |
| InChIKey | OIGLATSWYFIPNM-AADCDREDSA-N |
| XLogP | 12.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.18 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|