C56H101NO6 — CID 171792458
dibutyl (6Z,9Z,28Z,31Z)-19-[6-(dimethylamino)-3,3,5-trimethylhexanoyl]oxyheptatriaconta-6,9,28,31-tetraenedioate (PubChem CID 171792458) has the molecular formula C56H101NO6 and a molecular weight of 884.42 g/mol. Its IUPAC name is dibutyl (6Z,9Z,28Z,31Z)-19-[6-(dimethylamino)-3,3,5-trimethylhexanoyl]oxyheptatriaconta-6,9,28,31-tetraenedioate.
| Compound Name | dibutyl (6Z,9Z,28Z,31Z)-19-[6-(dimethylamino)-3,3,5-trimethylhexanoyl]oxyheptatriaconta-6,9,28,31-tetraenedioate |
|---|---|
| PubChem CID | 171792458 |
| Molecular Formula | C56H101NO6 |
| Molecular Weight | 884.42 g/mol |
| Exact Mass | 883.76 |
| IUPAC Name | dibutyl (6Z,9Z,28Z,31Z)-19-[6-(dimethylamino)-3,3,5-trimethylhexanoyl]oxyheptatriaconta-6,9,28,31-tetraenedioate |
| SMILES | CCCCOC(=O)CCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC(=O)OCCCC)OC(=O)CC(C)(C)CC(C)CN(C)C |
| InChI | InChI=1S/C56H101NO6/c1-8-10-46-61-53(58)44-40-36-32-28-24-20-16-12-14-18-22-26-30-34-38-42-52(63-55(60)49-56(4,5)48-51(3)50-57(6)7)43-39-35-31-27-23-19-15-13-17-21-25-29-33-37-41-45-54(59)62-47-11-9-2/h12-13,16-17,24-25,28-29,51-52H,8-11,14-15,18-23,26-27,30-50H2,1-7H3/b16-12-,17-13-,28-24-,29-25- |
| InChIKey | VTDWRJSJTFZZBN-GKGLZTMZSA-N |
| XLogP | 15.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.42 |
| LogP ≤ 5 | 15.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|