C47H87NO6 — CID 129287953
bis[(E)-non-2-enyl] 9-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptadecanedioate (PubChem CID 129287953) has the molecular formula C47H87NO6 and a molecular weight of 762.21 g/mol. Its IUPAC name is bis[(E)-non-2-enyl] 9-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptadecanedioate.
| Compound Name | bis[(E)-non-2-enyl] 9-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptadecanedioate |
|---|---|
| PubChem CID | 129287953 |
| Molecular Formula | C47H87NO6 |
| Molecular Weight | 762.21 g/mol |
| Exact Mass | 761.65 |
| IUPAC Name | bis[(E)-non-2-enyl] 9-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptadecanedioate |
| SMILES | CCCCCC/C=C/COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C/CCCCCC)OC(=O)CC(C)(C)CC(C)(C)CN(C)C |
| InChI | InChI=1S/C47H87NO6/c1-9-11-13-15-17-25-31-37-52-43(49)35-29-23-19-21-27-33-42(54-45(51)39-46(3,4)40-47(5,6)41-48(7)8)34-28-22-20-24-30-36-44(50)53-38-32-26-18-16-14-12-10-2/h25-26,31-32,42H,9-24,27-30,33-41H2,1-8H3/b31-25+,32-26+ |
| InChIKey | ORAUORCQBCAVGM-YESHOFFLSA-N |
| XLogP | 12.89 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.21 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|