C47H88N2O6 — CID 129254135
bis[(Z)-non-2-enyl] 9-[[5-(dimethylamino)-2,2,4,4-tetramethylpentoxy]carbonylamino]heptadecanedioate (PubChem CID 129254135) has the molecular formula C47H88N2O6 and a molecular weight of 777.23 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] 9-[[5-(dimethylamino)-2,2,4,4-tetramethylpentoxy]carbonylamino]heptadecanedioate.
| Compound Name | bis[(Z)-non-2-enyl] 9-[[5-(dimethylamino)-2,2,4,4-tetramethylpentoxy]carbonylamino]heptadecanedioate |
|---|---|
| PubChem CID | 129254135 |
| Molecular Formula | C47H88N2O6 |
| Molecular Weight | 777.23 g/mol |
| Exact Mass | 776.66 |
| IUPAC Name | bis[(Z)-non-2-enyl] 9-[[5-(dimethylamino)-2,2,4,4-tetramethylpentoxy]carbonylamino]heptadecanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C\CCCCCC)NC(=O)OCC(C)(C)CC(C)(C)CN(C)C |
| InChI | InChI=1S/C47H88N2O6/c1-9-11-13-15-17-25-31-37-53-43(50)35-29-23-19-21-27-33-42(48-45(52)55-41-47(5,6)39-46(3,4)40-49(7)8)34-28-22-20-24-30-36-44(51)54-38-32-26-18-16-14-12-10-2/h25-26,31-32,42H,9-24,27-30,33-41H2,1-8H3,(H,48,52)/b31-25-,32-26- |
| InChIKey | SZJMJYFSDAIQBX-WVMMTVHUSA-N |
| XLogP | 12.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.23 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|