C41H78N2O4 — CID 176869776
bis[(E)-dec-2-enyl] 9-[dimethylamino(methylamino)methyl]heptadecanedioate (PubChem CID 176869776) has the molecular formula C41H78N2O4 and a molecular weight of 663.09 g/mol. Its IUPAC name is bis[(E)-dec-2-enyl] 9-[dimethylamino(methylamino)methyl]heptadecanedioate.
| Compound Name | bis[(E)-dec-2-enyl] 9-[dimethylamino(methylamino)methyl]heptadecanedioate |
|---|---|
| PubChem CID | 176869776 |
| Molecular Formula | C41H78N2O4 |
| Molecular Weight | 663.09 g/mol |
| Exact Mass | 662.60 |
| IUPAC Name | bis[(E)-dec-2-enyl] 9-[dimethylamino(methylamino)methyl]heptadecanedioate |
| SMILES | CCCCCCC/C=C/COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C/CCCCCCC)C(NC)N(C)C |
| InChI | InChI=1S/C41H78N2O4/c1-6-8-10-12-14-16-24-30-36-46-39(44)34-28-22-18-20-26-32-38(41(42-3)43(4)5)33-27-21-19-23-29-35-40(45)47-37-31-25-17-15-13-11-9-7-2/h24-25,30-31,38,41-42H,6-23,26-29,32-37H2,1-5H3/b30-24+,31-25+ |
| InChIKey | LBWUVYQNHLWXLC-AMLXCYGQSA-N |
| XLogP | 11.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.09 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|