C46H87N2O5Zn- — CID 171792495
bis[(Z)-non-2-enyl] 9-(methanidylcarbamoyl)heptadecanedioate;N,N,2,2-tetramethylpentan-1-amine;zinc (PubChem CID 171792495) has the molecular formula C46H87N2O5Zn- and a molecular weight of 813.60 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] 9-(methanidylcarbamoyl)heptadecanedioate;N,N,2,2-tetramethylpentan-1-amine;zinc.
| Compound Name | bis[(Z)-non-2-enyl] 9-(methanidylcarbamoyl)heptadecanedioate;N,N,2,2-tetramethylpentan-1-amine;zinc |
|---|---|
| PubChem CID | 171792495 |
| Molecular Formula | C46H87N2O5Zn- |
| Molecular Weight | 813.60 g/mol |
| Exact Mass | 811.59 |
| IUPAC Name | bis[(Z)-non-2-enyl] 9-(methanidylcarbamoyl)heptadecanedioate;N,N,2,2-tetramethylpentan-1-amine;zinc |
| SMILES | CCCC(C)(C)CN(C)C.[CH2-]NC(=O)C(CCCCCCCC(=O)OC/C=C\CCCCCC)CCCCCCCC(=O)OC/C=C\CCCCCC.[Zn] |
| InChI | InChI=1S/C37H66NO5.C9H21N.Zn/c1-4-6-8-10-12-20-26-32-42-35(39)30-24-18-14-16-22-28-34(37(41)38-3)29-23-17-15-19-25-31-36(40)43-33-27-21-13-11-9-7-5-2;1-6-7-9(2,3)8-10(4)5;/h20-21,26-27,34H,3-19,22-25,28-33H2,1-2H3,(H,38,41);6-8H2,1-5H3;/q-1;;/b26-20-,27-21-;; |
| InChIKey | AWFKMBMMDVVGJT-QHVFIAGFSA-N |
| XLogP | 12.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.60 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|