C45H85N3O4 — CID 129254098
[(1Z,19Z)-1,19-bis[[(Z)-hept-2-enoxy]imino]nonadecan-10-yl] 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate (PubChem CID 129254098) has the molecular formula C45H85N3O4 and a molecular weight of 732.19 g/mol. Its IUPAC name is [(1Z,19Z)-1,19-bis[[(Z)-hept-2-enoxy]imino]nonadecan-10-yl] 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate.
| Compound Name | [(1Z,19Z)-1,19-bis[[(Z)-hept-2-enoxy]imino]nonadecan-10-yl] 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 129254098 |
| Molecular Formula | C45H85N3O4 |
| Molecular Weight | 732.19 g/mol |
| Exact Mass | 731.65 |
| IUPAC Name | [(1Z,19Z)-1,19-bis[[(Z)-hept-2-enoxy]imino]nonadecan-10-yl] 6-(dimethylamino)-3,3,5,5-tetramethylhexanoate |
| SMILES | CCCC/C=C\CO/N=C\CCCCCCCCC(CCCCCCCC/C=N\OC/C=C\CCCC)OC(=O)CC(C)(C)CC(C)(C)CN(C)C |
| InChI | InChI=1S/C45H85N3O4/c1-9-11-13-25-31-37-50-46-35-29-23-19-15-17-21-27-33-42(52-43(49)39-44(3,4)40-45(5,6)41-48(7)8)34-28-22-18-16-20-24-30-36-47-51-38-32-26-14-12-10-2/h25-26,31-32,35-36,42H,9-24,27-30,33-34,37-41H2,1-8H3/b31-25-,32-26-,46-35-,47-36- |
| InChIKey | XBZFLBLKHJECIB-GTVHECGRSA-N |
| XLogP | 13.03 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.19 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|