C39H73N3O4 — CID 58070069
[(1Z,19Z)-1,19-bis[[(E)-hept-2-enoxy]imino]nonadecan-10-yl] 4-(dimethylamino)butanoate (PubChem CID 58070069) has the molecular formula C39H73N3O4 and a molecular weight of 648.03 g/mol. Its IUPAC name is [(1Z,19Z)-1,19-bis[[(E)-hept-2-enoxy]imino]nonadecan-10-yl] 4-(dimethylamino)butanoate.
| Compound Name | [(1Z,19Z)-1,19-bis[[(E)-hept-2-enoxy]imino]nonadecan-10-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 58070069 |
| Molecular Formula | C39H73N3O4 |
| Molecular Weight | 648.03 g/mol |
| Exact Mass | 647.56 |
| IUPAC Name | [(1Z,19Z)-1,19-bis[[(E)-hept-2-enoxy]imino]nonadecan-10-yl] 4-(dimethylamino)butanoate |
| SMILES | CCCC/C=C/CO/N=C\CCCCCCCCC(CCCCCCCC/C=N\OC/C=C/CCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C39H73N3O4/c1-5-7-9-21-27-36-44-40-33-25-19-15-11-13-17-23-30-38(46-39(43)32-29-35-42(3)4)31-24-18-14-12-16-20-26-34-41-45-37-28-22-10-8-6-2/h21-22,27-28,33-34,38H,5-20,23-26,29-32,35-37H2,1-4H3/b27-21+,28-22+,40-33-,41-34- |
| InChIKey | GSVAZDWZYLFSAC-AFRAKXJFSA-N |
| XLogP | 10.98 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.03 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|