C49H91NO6 — CID 129253924
(9Z,28Z)-19-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptatriaconta-9,28-dienedioic acid (PubChem CID 129253924) has the molecular formula C49H91NO6 and a molecular weight of 790.27 g/mol. Its IUPAC name is (9Z,28Z)-19-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptatriaconta-9,28-dienedioic acid.
| Compound Name | (9Z,28Z)-19-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptatriaconta-9,28-dienedioic acid |
|---|---|
| PubChem CID | 129253924 |
| Molecular Formula | C49H91NO6 |
| Molecular Weight | 790.27 g/mol |
| Exact Mass | 789.68 |
| IUPAC Name | (9Z,28Z)-19-[6-(dimethylamino)-3,3,5,5-tetramethylhexanoyl]oxyheptatriaconta-9,28-dienedioic acid |
| SMILES | CN(C)CC(C)(C)CC(C)(C)CC(=O)OC(CCCCCCCC/C=C\CCCCCCCC(=O)O)CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C49H91NO6/c1-48(2,42-49(3,4)43-50(5)6)41-47(55)56-44(37-33-29-25-21-17-13-9-7-11-15-19-23-27-31-35-39-45(51)52)38-34-30-26-22-18-14-10-8-12-16-20-24-28-32-36-40-46(53)54/h7-8,11-12,44H,9-10,13-43H2,1-6H3,(H,51,52)(H,53,54)/b11-7-,12-8- |
| InChIKey | YSHHUFSCTLJUSY-OXAWKVHCSA-N |
| XLogP | 14.28 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.27 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|