C24H28N4O4 — CID 129254362
tert-butyl N-[2-formyl-3-[[2-(2-propan-2-ylpyrazol-3-yl)-3-pyridinyl]methoxy]phenyl]carbamate (PubChem CID 129254362) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is tert-butyl N-[2-formyl-3-[[2-(2-propan-2-ylpyrazol-3-yl)-3-pyridinyl]methoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-formyl-3-[[2-(2-propan-2-ylpyrazol-3-yl)-3-pyridinyl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 129254362 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tert-butyl N-[2-formyl-3-[[2-(2-propan-2-ylpyrazol-3-yl)-3-pyridinyl]methoxy]phenyl]carbamate |
| SMILES | CC(C)n1nccc1-c1ncccc1COc1cccc(NC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C24H28N4O4/c1-16(2)28-20(11-13-26-28)22-17(8-7-12-25-22)15-31-21-10-6-9-19(18(21)14-29)27-23(30)32-24(3,4)5/h6-14,16H,15H2,1-5H3,(H,27,30) |
| InChIKey | YZSNAGTWMWOXRN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|