C59H66Cl2N6O9S2 — CID 129257815
1,3-bis[4-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonyl-methylamino]butyl]urea (PubChem CID 129257815) has the molecular formula C59H66Cl2N6O9S2 and a molecular weight of 1138.25 g/mol. Its IUPAC name is 1,3-bis[4-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonyl-methylamino]butyl]urea.
| Compound Name | 1,3-bis[4-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonyl-methylamino]butyl]urea |
|---|---|
| PubChem CID | 129257815 |
| Molecular Formula | C59H66Cl2N6O9S2 |
| Molecular Weight | 1138.25 g/mol |
| Exact Mass | 1136.37 |
| IUPAC Name | 1,3-bis[4-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonyl-methylamino]butyl]urea |
| SMILES | CN(CCCCNC(=O)NCCCCN(C)S(=O)(=O)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)S(=O)(=O)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C59H66Cl2N6O9S2/c1-66(77(69,70)45-19-21-53(60)41(35-45)39-73-58(25-26-58)51-37-62-31-23-47(51)49-11-3-5-13-55(49)75-43-15-16-43)33-9-7-29-64-57(68)65-30-8-10-34-67(2)78(71,72)46-20-22-54(61)42(36-46)40-74-59(27-28-59)52-38-63-32-24-48(52)50-12-4-6-14-56(50)76-44-17-18-44/h3-6,11-14,19-24,31-32,35-38,43-44H,7-10,15-18,25-30,33-34,39-40H2,1-2H3,(H2,64,65,68) |
| InChIKey | XLPQPKKHVSIAJL-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.25 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|