C37H50N4O10S — CID 175607740
1-[4-[[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]sulfonyl-methylamino]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea (PubChem CID 175607740) has the molecular formula C37H50N4O10S and a molecular weight of 742.89 g/mol. Its IUPAC name is 1-[4-[[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]sulfonyl-methylamino]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea.
| Compound Name | 1-[4-[[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]sulfonyl-methylamino]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea |
|---|---|
| PubChem CID | 175607740 |
| Molecular Formula | C37H50N4O10S |
| Molecular Weight | 742.89 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | 1-[4-[[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]sulfonyl-methylamino]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCCCNC(=O)NCC(O)C(O)C(O)C(O)CO)cc1COC1(c2cnccc2-c2ccccc2OC2CC2)CC1 |
| InChI | InChI=1S/C37H50N4O10S/c1-24-9-12-27(52(48,49)41(2)18-6-5-16-39-36(47)40-21-31(43)34(45)35(46)32(44)22-42)19-25(24)23-50-37(14-15-37)30-20-38-17-13-28(30)29-7-3-4-8-33(29)51-26-10-11-26/h3-4,7-9,12-13,17,19-20,26,31-32,34-35,42-46H,5-6,10-11,14-16,18,21-23H2,1-2H3,(H2,39,40,47) |
| InChIKey | CXQHUSBMGTZUGE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 211.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|