C36H46ClN3O10S — CID 161271838
1-[5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylpentyl]-3-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]urea (PubChem CID 161271838) has the molecular formula C36H46ClN3O10S and a molecular weight of 748.29 g/mol. Its IUPAC name is 1-[5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylpentyl]-3-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]urea.
| Compound Name | 1-[5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylpentyl]-3-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]urea |
|---|---|
| PubChem CID | 161271838 |
| Molecular Formula | C36H46ClN3O10S |
| Molecular Weight | 748.29 g/mol |
| Exact Mass | 747.26 |
| IUPAC Name | 1-[5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylpentyl]-3-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]urea |
| SMILES | O=C(NCCCCCS(=O)(=O)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)NC[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C36H46ClN3O10S/c37-29-11-10-25(51(47,48)17-5-1-4-15-39-35(46)40-20-30(42)33(44)34(45)31(43)21-41)18-23(29)22-49-36(13-14-36)28-19-38-16-12-26(28)27-6-2-3-7-32(27)50-24-8-9-24/h2-3,6-7,10-12,16,18-19,24,30-31,33-34,41-45H,1,4-5,8-9,13-15,17,20-22H2,(H2,39,40,46)/t30-,31+,33+,34+/m1/s1 |
| InChIKey | VDXQGKLZVHJBNT-LVPKLHHISA-N |
| XLogP | 2.83 |
| TPSA | 207.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|