C35H44ClN3O10S — CID 139424211
5-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide (PubChem CID 139424211) has the molecular formula C35H44ClN3O10S and a molecular weight of 734.27 g/mol. Its IUPAC name is 5-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide.
| Compound Name | 5-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
|---|---|
| PubChem CID | 139424211 |
| Molecular Formula | C35H44ClN3O10S |
| Molecular Weight | 734.27 g/mol |
| Exact Mass | 733.24 |
| IUPAC Name | 5-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
| SMILES | O=C(CCCCNS(=O)(=O)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C35H44ClN3O10S/c36-28-11-10-24(50(46,47)39-15-4-3-7-32(43)38-19-29(41)33(44)34(45)30(42)20-40)17-22(28)21-48-35(13-14-35)27-18-37-16-12-25(27)26-5-1-2-6-31(26)49-23-8-9-23/h1-2,5-6,10-12,16-18,23,29-30,33-34,39-42,44-45H,3-4,7-9,13-15,19-21H2,(H,38,43) |
| InChIKey | CWSDWUCTRJDVBG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 207.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|