C36H46ClN3O10S — CID 139424173
6-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide (PubChem CID 139424173) has the molecular formula C36H46ClN3O10S and a molecular weight of 748.29 g/mol. Its IUPAC name is 6-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide.
| Compound Name | 6-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
|---|---|
| PubChem CID | 139424173 |
| Molecular Formula | C36H46ClN3O10S |
| Molecular Weight | 748.29 g/mol |
| Exact Mass | 747.26 |
| IUPAC Name | 6-[[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfonylamino]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C36H46ClN3O10S/c37-29-12-11-25(51(47,48)40-16-5-1-2-8-33(44)39-20-30(42)34(45)35(46)31(43)21-41)18-23(29)22-49-36(14-15-36)28-19-38-17-13-26(28)27-6-3-4-7-32(27)50-24-9-10-24/h3-4,6-7,11-13,17-19,24,30-31,34-35,40-43,45-46H,1-2,5,8-10,14-16,20-22H2,(H,39,44) |
| InChIKey | OQDLLWDABBEQKI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 207.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|