C38H51N3O8 — CID 175607698
1-[5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]hexyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea (PubChem CID 175607698) has the molecular formula C38H51N3O8 and a molecular weight of 677.84 g/mol. Its IUPAC name is 1-[5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]hexyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea.
| Compound Name | 1-[5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]hexyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea |
|---|---|
| PubChem CID | 175607698 |
| Molecular Formula | C38H51N3O8 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.37 |
| IUPAC Name | 1-[5-[3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-4-methylphenyl]hexyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea |
| SMILES | Cc1ccc(C(C)CCCCNC(=O)NCC(O)C(O)C(O)C(O)CO)cc1COC1(c2cnccc2-c2ccccc2OC2CC2)CC1 |
| InChI | InChI=1S/C38H51N3O8/c1-24(7-5-6-17-40-37(47)41-21-32(43)35(45)36(46)33(44)22-42)26-11-10-25(2)27(19-26)23-48-38(15-16-38)31-20-39-18-14-29(31)30-8-3-4-9-34(30)49-28-12-13-28/h3-4,8-11,14,18-20,24,28,32-33,35-36,42-46H,5-7,12-13,15-17,21-23H2,1-2H3,(H2,40,41,47) |
| InChIKey | CPPOPKRCRIPURS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 173.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|