C37H49ClN4O7 — CID 129242060
1-[(5R)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea (PubChem CID 129242060) has the molecular formula C37H49ClN4O7 and a molecular weight of 697.27 g/mol. Its IUPAC name is 1-[(5R)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea.
| Compound Name | 1-[(5R)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea |
|---|---|
| PubChem CID | 129242060 |
| Molecular Formula | C37H49ClN4O7 |
| Molecular Weight | 697.27 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | 1-[(5R)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea |
| SMILES | C[C@H](CCCCNC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C37H49ClN4O7/c1-23(6-4-5-16-40-36(48)41-21-31(44)34(46)35(47)32(45)22-43)24-9-12-30(38)25(18-24)19-42-37(14-15-37)29-20-39-17-13-27(29)28-7-2-3-8-33(28)49-26-10-11-26/h2-3,7-9,12-13,17-18,20,23,26,31-32,34-35,42-47H,4-6,10-11,14-16,19,21-22H2,1H3,(H2,40,41,48)/t23-,31+,32-,34-,35-/m1/s1 |
| InChIKey | ZRZHLHRROXJQBG-NFSYDDANSA-N |
| XLogP | 3.73 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|