C35H45ClN4O7 — CID 129241719
1-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]butyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea (PubChem CID 129241719) has the molecular formula C35H45ClN4O7 and a molecular weight of 669.22 g/mol. Its IUPAC name is 1-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]butyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea.
| Compound Name | 1-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]butyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea |
|---|---|
| PubChem CID | 129241719 |
| Molecular Formula | C35H45ClN4O7 |
| Molecular Weight | 669.22 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 1-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]butyl]-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]urea |
| SMILES | O=C(NCCCCc1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C35H45ClN4O7/c36-28-11-8-22(5-3-4-15-38-34(46)39-20-29(42)32(44)33(45)30(43)21-41)17-23(28)18-40-35(13-14-35)27-19-37-16-12-25(27)26-6-1-2-7-31(26)47-24-9-10-24/h1-2,6-8,11-12,16-17,19,24,29-30,32-33,40-45H,3-5,9-10,13-15,18,20-21H2,(H2,38,39,46)/t29-,30+,32+,33+/m0/s1 |
| InChIKey | UZJFHNYTRMLMLM-GITOVDKFSA-N |
| XLogP | 2.78 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|