C37H48ClN3O7 — CID 175607758
6-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide (PubChem CID 175607758) has the molecular formula C37H48ClN3O7 and a molecular weight of 682.26 g/mol. Its IUPAC name is 6-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide.
| Compound Name | 6-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide |
|---|---|
| PubChem CID | 175607758 |
| Molecular Formula | C37H48ClN3O7 |
| Molecular Weight | 682.26 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | 6-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide |
| SMILES | CC(CCCCC(=O)NCC(O)C(O)C(O)C(O)CO)c1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C37H48ClN3O7/c1-23(6-2-5-9-34(45)40-21-31(43)35(46)36(47)32(44)22-42)24-10-13-30(38)25(18-24)19-41-37(15-16-37)29-20-39-17-14-27(29)28-7-3-4-8-33(28)48-26-11-12-26/h3-4,7-8,10,13-14,17-18,20,23,26,31-32,35-36,41-44,46-47H,2,5-6,9,11-12,15-16,19,21-22H2,1H3,(H,40,45) |
| InChIKey | SBPSOGDSZQCLSX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|