C38H51N3O7 — CID 129242472
5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide (PubChem CID 129242472) has the molecular formula C38H51N3O7 and a molecular weight of 661.84 g/mol. Its IUPAC name is 5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide.
| Compound Name | 5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
|---|---|
| PubChem CID | 129242472 |
| Molecular Formula | C38H51N3O7 |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.37 |
| IUPAC Name | 5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
| SMILES | Cc1ccc(C(C)CCCC(=O)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1CNC1(c2cnccc2-c2ccccc2OC2CC2)CC1 |
| InChI | InChI=1S/C38H51N3O7/c1-24(7-6-10-35(45)41(3)22-32(43)36(46)37(47)33(44)23-42)26-12-11-25(2)27(19-26)20-40-38(16-17-38)31-21-39-18-15-29(31)30-8-4-5-9-34(30)48-28-13-14-28/h4-5,8-9,11-12,15,18-19,21,24,28,32-33,36-37,40,42-44,46-47H,6-7,10,13-14,16-17,20,22-23H2,1-3H3/t24?,32-,33+,36+,37+/m0/s1 |
| InChIKey | XVSBNFMNNNPQPK-YMPVADNQSA-N |
| XLogP | 3.55 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |