C39H52ClN3O8 — CID 140792941
N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]pentyl]-2,3,4,5,6-pentahydroxy-N-(4-hydroxybutyl)hexanamide (PubChem CID 140792941) has the molecular formula C39H52ClN3O8 and a molecular weight of 726.31 g/mol. Its IUPAC name is N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]pentyl]-2,3,4,5,6-pentahydroxy-N-(4-hydroxybutyl)hexanamide.
| Compound Name | N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]pentyl]-2,3,4,5,6-pentahydroxy-N-(4-hydroxybutyl)hexanamide |
|---|---|
| PubChem CID | 140792941 |
| Molecular Formula | C39H52ClN3O8 |
| Molecular Weight | 726.31 g/mol |
| Exact Mass | 725.34 |
| IUPAC Name | N-[4-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]pentyl]-2,3,4,5,6-pentahydroxy-N-(4-hydroxybutyl)hexanamide |
| SMILES | CC(CCCN(CCCCO)C(=O)C(O)C(O)C(O)C(O)CO)c1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C39H52ClN3O8/c1-25(7-6-19-43(18-4-5-20-44)38(50)37(49)36(48)35(47)33(46)24-45)26-10-13-32(40)27(21-26)22-42-39(15-16-39)31-23-41-17-14-29(31)30-8-2-3-9-34(30)51-28-11-12-28/h2-3,8-10,13-14,17,21,23,25,28,33,35-37,42,44-49H,4-7,11-12,15-16,18-20,22,24H2,1H3 |
| InChIKey | QAYLRLDAVXHPPR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 175.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|