C37H49ClN4O6 — CID 129267186
1-[(5S)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]urea (PubChem CID 129267186) has the molecular formula C37H49ClN4O6 and a molecular weight of 681.27 g/mol. Its IUPAC name is 1-[(5S)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]urea.
| Compound Name | 1-[(5S)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]urea |
|---|---|
| PubChem CID | 129267186 |
| Molecular Formula | C37H49ClN4O6 |
| Molecular Weight | 681.27 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | 1-[(5S)-5-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]hexyl]-3-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]urea |
| SMILES | C[C@@H](CCCCNC(=O)NC[C@H](O)[C@@H](O)[C@H](O)CCO)c1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C37H49ClN4O6/c1-24(6-4-5-17-40-36(47)41-23-33(45)35(46)32(44)14-19-43)25-9-12-31(38)26(20-25)21-42-37(15-16-37)30-22-39-18-13-28(30)29-7-2-3-8-34(29)48-27-10-11-27/h2-3,7-9,12-13,18,20,22,24,27,32-33,35,42-46H,4-6,10-11,14-17,19,21,23H2,1H3,(H2,40,41,47)/t24-,32+,33-,35-/m0/s1 |
| InChIKey | KNJQQBPMHPPALN-ILCZOMEGSA-N |
| XLogP | 4.76 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|