C37H48ClN3O8 — CID 129241913
1-[(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea (PubChem CID 129241913) has the molecular formula C37H48ClN3O8 and a molecular weight of 698.26 g/mol. Its IUPAC name is 1-[(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea.
| Compound Name | 1-[(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea |
|---|---|
| PubChem CID | 129241913 |
| Molecular Formula | C37H48ClN3O8 |
| Molecular Weight | 698.26 g/mol |
| Exact Mass | 697.31 |
| IUPAC Name | 1-[(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea |
| SMILES | C[C@H](CCCCNC(=O)N[C@@H](CO)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C37H48ClN3O8/c1-23(6-4-5-16-40-36(47)41-31(20-42)34(45)35(46)32(44)21-43)24-9-12-30(38)25(18-24)22-48-37(14-15-37)29-19-39-17-13-27(29)28-7-2-3-8-33(28)49-26-10-11-26/h2-3,7-9,12-13,17-19,23,26,31-32,34-35,42-46H,4-6,10-11,14-16,20-22H2,1H3,(H2,40,41,47)/t23-,31+,32-,34-,35-/m1/s1 |
| InChIKey | NFGFTIBIGVQPIP-NFSYDDANSA-N |
| XLogP | 4.16 |
| TPSA | 173.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|