C35H44ClN3O8S — CID 129242274
1-[4-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfanylbutyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea (PubChem CID 129242274) has the molecular formula C35H44ClN3O8S and a molecular weight of 702.27 g/mol. Its IUPAC name is 1-[4-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfanylbutyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea.
| Compound Name | 1-[4-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfanylbutyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea |
|---|---|
| PubChem CID | 129242274 |
| Molecular Formula | C35H44ClN3O8S |
| Molecular Weight | 702.27 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | 1-[4-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]sulfanylbutyl]-3-[(2S,3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]urea |
| SMILES | O=C(NCCCCSc1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)N[C@@H](CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C35H44ClN3O8S/c36-28-10-9-24(48-16-4-3-14-38-34(45)39-29(19-40)32(43)33(44)30(42)20-41)17-22(28)21-46-35(12-13-35)27-18-37-15-11-25(27)26-5-1-2-6-31(26)47-23-7-8-23/h1-2,5-6,9-11,15,17-18,23,29-30,32-33,40-44H,3-4,7-8,12-14,16,19-21H2,(H2,38,39,45)/t29-,30+,32+,33+/m0/s1 |
| InChIKey | PUVDRDTZUYGCEI-GITOVDKFSA-N |
| XLogP | 3.76 |
| TPSA | 173.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|