C31H35ClN2O4 — CID 129242198
[(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]carbamic acid (PubChem CID 129242198) has the molecular formula C31H35ClN2O4 and a molecular weight of 535.08 g/mol. Its IUPAC name is [(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]carbamic acid.
| Compound Name | [(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]carbamic acid |
|---|---|
| PubChem CID | 129242198 |
| Molecular Formula | C31H35ClN2O4 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | [(5R)-5-[4-chloro-3-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]hexyl]carbamic acid |
| SMILES | C[C@H](CCCCNC(=O)O)c1ccc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C31H35ClN2O4/c1-21(6-4-5-16-34-30(35)36)22-9-12-28(32)23(18-22)20-37-31(14-15-31)27-19-33-17-13-25(27)26-7-2-3-8-29(26)38-24-10-11-24/h2-3,7-9,12-13,17-19,21,24,34H,4-6,10-11,14-16,20H2,1H3,(H,35,36)/t21-/m1/s1 |
| InChIKey | GTBFNZAUOIRJKZ-OAQYLSRUSA-N |
| XLogP | 7.69 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|