C39H51ClN4O8S — CID 140792990
N-(4-acetamidobutyl)-N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 140792990) has the molecular formula C39H51ClN4O8S and a molecular weight of 771.38 g/mol. Its IUPAC name is N-(4-acetamidobutyl)-N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-(4-acetamidobutyl)-N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 140792990 |
| Molecular Formula | C39H51ClN4O8S |
| Molecular Weight | 771.38 g/mol |
| Exact Mass | 770.31 |
| IUPAC Name | N-(4-acetamidobutyl)-N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CC(=O)NCCCCN(CCCSc1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C39H51ClN4O8S/c1-25(46)42-16-4-5-18-44(38(51)37(50)36(49)35(48)33(47)24-45)19-6-20-53-28-11-12-32(40)26(21-28)22-43-39(14-15-39)31-23-41-17-13-29(31)30-7-2-3-8-34(30)52-27-9-10-27/h2-3,7-8,11-13,17,21,23,27,33,35-37,43,45,47-50H,4-6,9-10,14-16,18-20,22,24H2,1H3,(H,42,46) |
| InChIKey | YPFCZYPAFWMNAZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|