C38H48ClN3O8S — CID 140793035
N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxy-N-(oxan-4-yl)hexanamide (PubChem CID 140793035) has the molecular formula C38H48ClN3O8S and a molecular weight of 742.33 g/mol. Its IUPAC name is N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxy-N-(oxan-4-yl)hexanamide.
| Compound Name | N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxy-N-(oxan-4-yl)hexanamide |
|---|---|
| PubChem CID | 140793035 |
| Molecular Formula | C38H48ClN3O8S |
| Molecular Weight | 742.33 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | N-[3-[4-chloro-3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]sulfanylpropyl]-2,3,4,5,6-pentahydroxy-N-(oxan-4-yl)hexanamide |
| SMILES | O=C(C(O)C(O)C(O)C(O)CO)N(CCCSc1ccc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1)C1CCOCC1 |
| InChI | InChI=1S/C38H48ClN3O8S/c39-31-9-8-27(51-19-3-16-42(25-11-17-49-18-12-25)37(48)36(47)35(46)34(45)32(44)23-43)20-24(31)21-41-38(13-14-38)30-22-40-15-10-28(30)29-4-1-2-5-33(29)50-26-6-7-26/h1-2,4-5,8-10,15,20,22,25-26,32,34-36,41,43-47H,3,6-7,11-14,16-19,21,23H2 |
| InChIKey | QZBZZNLNTDDWFF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 164.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|