C36H45Cl2N3O7 — CID 175607834
5-[2,5-dichloro-4-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide (PubChem CID 175607834) has the molecular formula C36H45Cl2N3O7 and a molecular weight of 702.68 g/mol. Its IUPAC name is 5-[2,5-dichloro-4-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide.
| Compound Name | 5-[2,5-dichloro-4-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
|---|---|
| PubChem CID | 175607834 |
| Molecular Formula | C36H45Cl2N3O7 |
| Molecular Weight | 702.68 g/mol |
| Exact Mass | 701.26 |
| IUPAC Name | 5-[2,5-dichloro-4-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCCCc1cc(Cl)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C36H45Cl2N3O7/c1-41(20-30(43)34(46)35(47)31(44)21-42)33(45)9-5-2-6-22-16-29(38)23(17-28(22)37)18-40-36(13-14-36)27-19-39-15-12-25(27)26-7-3-4-8-32(26)48-24-10-11-24/h3-4,7-8,12,15-17,19,24,30-31,34-35,40,42-44,46-47H,2,5-6,9-11,13-14,18,20-21H2,1H3 |
| InChIKey | REBATSDIZKGIMD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|