About (1Z)-3,3-difluorocyclooctene
(1Z)-3,3-difluorocyclooctene (PubChem CID 129263045) has the molecular formula C8H12F2
and a molecular weight of 146.18 g/mol. Its IUPAC name is (1Z)-3,3-difluorocyclooctene.
Molecular Properties
| Compound Name | (1Z)-3,3-difluorocyclooctene |
| PubChem CID | 129263045 |
| Molecular Formula | C8H12F2 |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (1Z)-3,3-difluorocyclooctene |
| SMILES | FC1(F)/C=C\CCCCC1 |
| InChI | InChI=1S/C8H12F2/c9-8(10)6-4-2-1-3-5-7-8/h4,6H,1-3,5,7H2/b6-4- |
| InChIKey | RDEGLOWAAZUNQP-XQRVVYSFSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3,3-difluorocyclooctene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3,3-difluorocyclooctene?
The IUPAC name of (1Z)-3,3-difluorocyclooctene (CID 129263045) is (1Z)-3,3-difluorocyclooctene.
What is the SMILES notation for (1Z)-3,3-difluorocyclooctene?
The canonical SMILES for (1Z)-3,3-difluorocyclooctene is FC1(F)/C=C\CCCCC1.
What is the InChIKey of (1Z)-3,3-difluorocyclooctene?
The InChIKey is RDEGLOWAAZUNQP-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H12F2/c9-8(10)6-4-2-1-3-5-7-8/h4,6H,1-3,5,7H2/b6-4-.
What are the key properties of (1Z)-3,3-difluorocyclooctene?
(1Z)-3,3-difluorocyclooctene has a molecular weight of 146.18 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3,3-difluorocyclooctene is sourced from PubChem (CID 129263045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).