C8H12F2 — CID 129263045
(1Z)-3,3-difluorocyclooctene (PubChem CID 129263045) has the molecular formula C8H12F2 and a molecular weight of 146.18 g/mol. Its IUPAC name is (1Z)-3,3-difluorocyclooctene.
| Compound Name | (1Z)-3,3-difluorocyclooctene |
|---|---|
| PubChem CID | 129263045 |
| Molecular Formula | C8H12F2 |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (1Z)-3,3-difluorocyclooctene |
| SMILES | FC1(F)/C=C\CCCCC1 |
| InChI | InChI=1S/C8H12F2/c9-8(10)6-4-2-1-3-5-7-8/h4,6H,1-3,5,7H2/b6-4- |
| InChIKey | RDEGLOWAAZUNQP-XQRVVYSFSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|