C11H16O4 — CID 154315592
cyclonon-2-ene-1,1-dicarboxylic acid (PubChem CID 154315592) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is cyclonon-2-ene-1,1-dicarboxylic acid.
| Compound Name | cyclonon-2-ene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 154315592 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | cyclonon-2-ene-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)C=CCCCCCC1 |
| InChI | InChI=1S/C11H16O4/c12-9(13)11(10(14)15)7-5-3-1-2-4-6-8-11/h5,7H,1-4,6,8H2,(H,12,13)(H,14,15) |
| InChIKey | BJJGNHIAFXXGAD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|