C12H18O7 — CID 12926389
(1S,2S,6S,8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid (PubChem CID 12926389) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is (1S,2S,6S,8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid.
| Compound Name | (1S,2S,6S,8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid |
|---|---|
| PubChem CID | 12926389 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1S,2S,6S,8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid |
| SMILES | CC1(C)O[C@@H]2O[C@H]3C(C(=O)O)OC(C)(C)O[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C12H18O7/c1-11(2)16-6-5(7(17-11)9(13)14)15-10-8(6)18-12(3,4)19-10/h5-8,10H,1-4H3,(H,13,14)/t5-,6+,7?,8+,10+/m1/s1 |
| InChIKey | TVQAOBZTOMKPNW-LPXXBSPGSA-N |
| XLogP | 0.47 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |