C9H11Cl2N2O6PS — CID 129264300
5-[(2S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 129264300) has the molecular formula C9H11Cl2N2O6PS and a molecular weight of 377.14 g/mol. Its IUPAC name is 5-[(2S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[(2S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 129264300 |
| Molecular Formula | C9H11Cl2N2O6PS |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 5-[(2S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]cc1[C@@H]1O[C@H](COP(=O)(Cl)Cl)C(O)C1O |
| InChI | InChI=1S/C9H11Cl2N2O6PS/c10-20(11,17)18-2-4-5(14)6(15)7(19-4)3-1-12-9(21)13-8(3)16/h1,4-7,14-15H,2H2,(H2,12,13,16,21)/t4-,5?,6?,7+/m1/s1 |
| InChIKey | KUCZHLIXBLUREJ-BLOUUBGSSA-N |
| XLogP | 1.20 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|