C10H13Cl2N2O7P — CID 129144206
5-[(2S,3S,4R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 129144206) has the molecular formula C10H13Cl2N2O7P and a molecular weight of 375.10 g/mol. Its IUPAC name is 5-[(2S,3S,4R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2S,3S,4R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129144206 |
| Molecular Formula | C10H13Cl2N2O7P |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 5-[(2S,3S,4R,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]cc([C@@H]2O[C@H](COP(=O)(Cl)Cl)[C@H](O)[C@@H]2O)c1=O |
| InChI | InChI=1S/C10H13Cl2N2O7P/c1-14-9(17)4(2-13-10(14)18)8-7(16)6(15)5(21-8)3-20-22(11,12)19/h2,5-8,15-16H,3H2,1H3,(H,13,18)/t5-,6+,7+,8+/m1/s1 |
| InChIKey | YJMCVCXYMNLXOH-KVPKETBZSA-N |
| XLogP | -0.16 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|