C10H13Cl2N2O7PS — CID 45104742
1-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-6-methylsulfanylpyrimidine-2,4-dione (PubChem CID 45104742) has the molecular formula C10H13Cl2N2O7PS and a molecular weight of 407.17 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-6-methylsulfanylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-6-methylsulfanylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45104742 |
| Molecular Formula | C10H13Cl2N2O7PS |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-6-methylsulfanylpyrimidine-2,4-dione |
| SMILES | CSc1cc(=O)[nH]c(=O)n1[C@@H]1O[C@H](COP(=O)(Cl)Cl)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13Cl2N2O7PS/c1-23-6-2-5(15)13-10(18)14(6)9-8(17)7(16)4(21-9)3-20-22(11,12)19/h2,4,7-9,16-17H,3H2,1H3,(H,13,15,18)/t4-,7-,8-,9-/m1/s1 |
| InChIKey | QMSALNZOMSDGHL-XCBZGROMSA-N |
| XLogP | 0.48 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|