C9H14N2O11P2S — CID 16733813
[(2R,3S,4R,5R)-5-(6-dihydroxyphosphinothioyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 16733813) has the molecular formula C9H14N2O11P2S and a molecular weight of 420.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-dihydroxyphosphinothioyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-dihydroxyphosphinothioyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 16733813 |
| Molecular Formula | C9H14N2O11P2S |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-dihydroxyphosphinothioyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1cc(P(O)(O)=S)n([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O11P2S/c12-4-1-5(23(16,17)25)11(9(15)10-4)8-7(14)6(13)3(22-8)2-21-24(18,19)20/h1,3,6-8,13-14H,2H2,(H,10,12,15)(H2,16,17,25)(H2,18,19,20)/t3-,6-,7-,8-/m1/s1 |
| InChIKey | MEDXJHXAVQWNAN-YXZULKJRSA-N |
| XLogP | -3.82 |
| TPSA | 211.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|