C9H15N5O6 — CID 89495546
3-amino-5-[(2S,5R)-3-aminooxy-5-(aminooxymethyl)-4-hydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 89495546) has the molecular formula C9H15N5O6 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-amino-5-[(2S,5R)-3-aminooxy-5-(aminooxymethyl)-4-hydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-amino-5-[(2S,5R)-3-aminooxy-5-(aminooxymethyl)-4-hydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89495546 |
| Molecular Formula | C9H15N5O6 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-amino-5-[(2S,5R)-3-aminooxy-5-(aminooxymethyl)-4-hydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | NOC[C@H]1O[C@@H](c2c[nH]c(=O)n(N)c2=O)C(ON)C1O |
| InChI | InChI=1S/C9H15N5O6/c10-14-8(16)3(1-13-9(14)17)6-7(20-12)5(15)4(19-6)2-18-11/h1,4-7,15H,2,10-12H2,(H,13,17)/t4-,5?,6+,7?/m1/s1 |
| InChIKey | JIDZIVAGLIVREG-JEUXIKPASA-N |
| XLogP | -3.80 |
| TPSA | 180.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|