C23H30N5O3PS — CID 12926603
1-bis(phenylmethoxy)phosphoryl-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 12926603) has the molecular formula C23H30N5O3PS and a molecular weight of 487.57 g/mol. Its IUPAC name is 1-bis(phenylmethoxy)phosphoryl-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-bis(phenylmethoxy)phosphoryl-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 12926603 |
| Molecular Formula | C23H30N5O3PS |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-bis(phenylmethoxy)phosphoryl-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(\NCCSCc1nc[nH]c1C)NP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H30N5O3PS/c1-19-22(27-18-26-19)17-33-14-13-25-23(24-2)28-32(29,30-15-20-9-5-3-6-10-20)31-16-21-11-7-4-8-12-21/h3-12,18H,13-17H2,1-2H3,(H,26,27)(H2,24,25,28,29) |
| InChIKey | JNIZZUYHDUWKGQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|