C5H5Cl2N3S — CID 12926758
4,6-dichloro-5-methylsulfanylpyrimidin-2-amine (PubChem CID 12926758) has the molecular formula C5H5Cl2N3S and a molecular weight of 210.09 g/mol. Its IUPAC name is 4,6-dichloro-5-methylsulfanylpyrimidin-2-amine.
| Compound Name | 4,6-dichloro-5-methylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 12926758 |
| Molecular Formula | C5H5Cl2N3S |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | 4,6-dichloro-5-methylsulfanylpyrimidin-2-amine |
| SMILES | CSc1c(Cl)nc(N)nc1Cl |
| InChI | InChI=1S/C5H5Cl2N3S/c1-11-2-3(6)9-5(8)10-4(2)7/h1H3,(H2,8,9,10) |
| InChIKey | QYEHUJHOZPDALA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |