C21H20FN3O5 — CID 129267646
(2E,4E,6E)-5-[3-[1-[[6-(cyclopropanecarbonyl)-3-pyridinyl]oxy]ethyl]-1,2,4-oxadiazol-5-yl]-7-fluoro-2-methylhepta-2,4,6-trienoic acid (PubChem CID 129267646) has the molecular formula C21H20FN3O5 and a molecular weight of 413.41 g/mol. Its IUPAC name is (2E,4E,6E)-5-[3-[1-[[6-(cyclopropanecarbonyl)-3-pyridinyl]oxy]ethyl]-1,2,4-oxadiazol-5-yl]-7-fluoro-2-methylhepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-5-[3-[1-[[6-(cyclopropanecarbonyl)-3-pyridinyl]oxy]ethyl]-1,2,4-oxadiazol-5-yl]-7-fluoro-2-methylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 129267646 |
| Molecular Formula | C21H20FN3O5 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (2E,4E,6E)-5-[3-[1-[[6-(cyclopropanecarbonyl)-3-pyridinyl]oxy]ethyl]-1,2,4-oxadiazol-5-yl]-7-fluoro-2-methylhepta-2,4,6-trienoic acid |
| SMILES | C/C(=C\C=C(/C=C/F)c1nc(C(C)Oc2ccc(C(=O)C3CC3)nc2)no1)C(=O)O |
| InChI | InChI=1S/C21H20FN3O5/c1-12(21(27)28)3-4-15(9-10-22)20-24-19(25-30-20)13(2)29-16-7-8-17(23-11-16)18(26)14-5-6-14/h3-4,7-11,13-14H,5-6H2,1-2H3,(H,27,28)/b10-9+,12-3+,15-4+ |
| InChIKey | XAJXMWQRUDBDPF-ZETSGYFOSA-N |
| XLogP | 4.09 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|