C15H17FN6O — CID 129267860
1-[3-fluoro-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-iminopropan-1-one (PubChem CID 129267860) has the molecular formula C15H17FN6O and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-[3-fluoro-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-iminopropan-1-one.
| Compound Name | 1-[3-fluoro-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-iminopropan-1-one |
|---|---|
| PubChem CID | 129267860 |
| Molecular Formula | C15H17FN6O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[3-fluoro-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-iminopropan-1-one |
| SMILES | [H]/N=C/CC(=O)N1CC(F)C12CCN(c1ncnc3[nH]ccc13)C2 |
| InChI | InChI=1S/C15H17FN6O/c16-11-7-22(12(23)1-4-17)15(11)3-6-21(8-15)14-10-2-5-18-13(10)19-9-20-14/h2,4-5,9,11,17H,1,3,6-8H2,(H,18,19,20)/b17-4+ |
| InChIKey | JTMDLMGISKNHDK-HAVNEIBRSA-N |
| XLogP | 1.13 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|