C17H27NO2 — CID 129268164
2-[(2S,6S)-6-methyl-4-(4-propan-2-ylphenyl)morpholin-2-yl]propan-2-ol (PubChem CID 129268164) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[(2S,6S)-6-methyl-4-(4-propan-2-ylphenyl)morpholin-2-yl]propan-2-ol.
| Compound Name | 2-[(2S,6S)-6-methyl-4-(4-propan-2-ylphenyl)morpholin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 129268164 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[(2S,6S)-6-methyl-4-(4-propan-2-ylphenyl)morpholin-2-yl]propan-2-ol |
| SMILES | CC(C)c1ccc(N2C[C@@H](C(C)(C)O)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-12(2)14-6-8-15(9-7-14)18-10-13(3)20-16(11-18)17(4,5)19/h6-9,12-13,16,19H,10-11H2,1-5H3/t13-,16-/m0/s1 |
| InChIKey | LKTYCIGHKXJRTM-BBRMVZONSA-N |
| XLogP | 3.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|