C7H11NO3 — CID 12926903
3-[(E)-hydroxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 12926903) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-[(E)-hydroxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[(E)-hydroxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 12926903 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3-[(E)-hydroxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(/C=N/O)C1C(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-7(2)4(3-8-11)5(7)6(9)10/h3-5,11H,1-2H3,(H,9,10)/b8-3+ |
| InChIKey | BAGLJZNYWNJMEH-FPYGCLRLSA-N |
| XLogP | 0.80 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|