About trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid
trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid (PubChem CID 88786057) has the molecular formula C8H10F3NO3
and a molecular weight of 225.17 g/mol. Its IUPAC name is trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid |
| PubChem CID | 88786057 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1C=NOC(F)(F)F |
| InChI | InChI=1S/C8H10F3NO3/c1-7(2)4(5(7)6(13)14)3-12-15-8(9,10)11/h3-5H,1-2H3,(H,13,14)/t4-,5-/m0/s1 |
| InChIKey | QCDOJNDUHHFEJB-WHFBIAKZSA-N |
| XLogP | 1.87 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid?
The IUPAC name of trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid (CID 88786057) is trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid is CC1(C)[C@H](C(=O)O)[C@@H]1C=NOC(F)(F)F.
What is the InChIKey of trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid?
The InChIKey is QCDOJNDUHHFEJB-WHFBIAKZSA-N. The full InChI is InChI=1S/C8H10F3NO3/c1-7(2)4(5(7)6(13)14)3-12-15-8(9,10)11/h3-5H,1-2H3,(H,13,14)/t4-,5-/m0/s1.
What are the key properties of trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid?
trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid has a molecular weight of 225.17 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3S)-2,2-dimethyl-3-(trifluoromethoxyiminomethyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 88786057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).