C10H11F3INO2 — CID 129269757
2,2,2-trifluoroethyl 3-iodo-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 129269757) has the molecular formula C10H11F3INO2 and a molecular weight of 361.10 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-iodo-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 3-iodo-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 129269757 |
| Molecular Formula | C10H11F3INO2 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-iodo-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | O=C(OCC(F)(F)F)N1C2C=C(I)CC1CC2 |
| InChI | InChI=1S/C10H11F3INO2/c11-10(12,13)5-17-9(16)15-7-1-2-8(15)4-6(14)3-7/h3,7-8H,1-2,4-5H2 |
| InChIKey | QFYSWLGAXNWDLH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|