C15H29N — CID 129273725
1-(1,3-diethyl-3-methylcyclohexyl)pyrrolidine (PubChem CID 129273725) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 1-(1,3-diethyl-3-methylcyclohexyl)pyrrolidine.
| Compound Name | 1-(1,3-diethyl-3-methylcyclohexyl)pyrrolidine |
|---|---|
| PubChem CID | 129273725 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 1-(1,3-diethyl-3-methylcyclohexyl)pyrrolidine |
| SMILES | CCC1(C)CCCC(CC)(N2CCCC2)C1 |
| InChI | InChI=1S/C15H29N/c1-4-14(3)9-8-10-15(5-2,13-14)16-11-6-7-12-16/h4-13H2,1-3H3 |
| InChIKey | AVOGLTCZTLCXSC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |