C15H20N6O2S — CID 129273726
(2S)-2-[(1S)-2-(2-amino-1,3-benzothiazol-4-yl)-1-(2H-tetrazol-5-yl)ethyl]pentane-1,1-diol (PubChem CID 129273726) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-(2-amino-1,3-benzothiazol-4-yl)-1-(2H-tetrazol-5-yl)ethyl]pentane-1,1-diol.
| Compound Name | (2S)-2-[(1S)-2-(2-amino-1,3-benzothiazol-4-yl)-1-(2H-tetrazol-5-yl)ethyl]pentane-1,1-diol |
|---|---|
| PubChem CID | 129273726 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2S)-2-[(1S)-2-(2-amino-1,3-benzothiazol-4-yl)-1-(2H-tetrazol-5-yl)ethyl]pentane-1,1-diol |
| SMILES | CCC[C@H](C(O)O)[C@H](Cc1cccc2sc(N)nc12)c1nn[nH]n1 |
| InChI | InChI=1S/C15H20N6O2S/c1-2-4-9(14(22)23)10(13-18-20-21-19-13)7-8-5-3-6-11-12(8)17-15(16)24-11/h3,5-6,9-10,14,22-23H,2,4,7H2,1H3,(H2,16,17)(H,18,19,20,21)/t9-,10-/m0/s1 |
| InChIKey | WBZIVEVXZXXCDU-UWVGGRQHSA-N |
| XLogP | 1.44 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|